C14H11F3N4O4S — CID 29409709
N-[2-[2-[2-nitro-4-(trifluoromethyl)phenyl]hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 29409709) has the molecular formula C14H11F3N4O4S and a molecular weight of 388.33 g/mol. Its IUPAC name is N-[2-[2-[2-nitro-4-(trifluoromethyl)phenyl]hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[2-[2-nitro-4-(trifluoromethyl)phenyl]hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 29409709 |
| Molecular Formula | C14H11F3N4O4S |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | N-[2-[2-[2-nitro-4-(trifluoromethyl)phenyl]hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1cccs1)NNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H11F3N4O4S/c15-14(16,17)8-3-4-9(10(6-8)21(24)25)19-20-12(22)7-18-13(23)11-2-1-5-26-11/h1-6,19H,7H2,(H,18,23)(H,20,22) |
| InChIKey | YPSUOGRFKCNPHV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|