C17H16F3N3O4S — CID 29409912
4-(2,5-dimethylthiophen-3-yl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]-4-oxobutanehydrazide (PubChem CID 29409912) has the molecular formula C17H16F3N3O4S and a molecular weight of 415.39 g/mol. Its IUPAC name is 4-(2,5-dimethylthiophen-3-yl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]-4-oxobutanehydrazide.
| Compound Name | 4-(2,5-dimethylthiophen-3-yl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]-4-oxobutanehydrazide |
|---|---|
| PubChem CID | 29409912 |
| Molecular Formula | C17H16F3N3O4S |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 4-(2,5-dimethylthiophen-3-yl)-N'-[2-nitro-4-(trifluoromethyl)phenyl]-4-oxobutanehydrazide |
| SMILES | Cc1cc(C(=O)CCC(=O)NNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c(C)s1 |
| InChI | InChI=1S/C17H16F3N3O4S/c1-9-7-12(10(2)28-9)15(24)5-6-16(25)22-21-13-4-3-11(17(18,19)20)8-14(13)23(26)27/h3-4,7-8,21H,5-6H2,1-2H3,(H,22,25) |
| InChIKey | MSJRMQDJLQWGOC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|