C21H22F3N5O3S — CID 138603669
N-[[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-3-pyridinyl]methyl]-N'-[2-nitro-4-(trifluoromethyl)phenyl]ethane-1,2-diamine (PubChem CID 138603669) has the molecular formula C21H22F3N5O3S and a molecular weight of 481.50 g/mol. Its IUPAC name is N-[[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-3-pyridinyl]methyl]-N'-[2-nitro-4-(trifluoromethyl)phenyl]ethane-1,2-diamine.
| Compound Name | N-[[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-3-pyridinyl]methyl]-N'-[2-nitro-4-(trifluoromethyl)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 138603669 |
| Molecular Formula | C21H22F3N5O3S |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | N-[[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-3-pyridinyl]methyl]-N'-[2-nitro-4-(trifluoromethyl)phenyl]ethane-1,2-diamine |
| SMILES | Cc1noc(C)c1CSc1ncccc1CNCCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H22F3N5O3S/c1-13-17(14(2)32-28-13)12-33-20-15(4-3-7-27-20)11-25-8-9-26-18-6-5-16(21(22,23)24)10-19(18)29(30)31/h3-7,10,25-26H,8-9,11-12H2,1-2H3 |
| InChIKey | KJRBCWXFVFVUIP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|