C15H12F4N4O2S — CID 24501812
1-[(4-fluorophenyl)methyl]-3-[2-nitro-4-(trifluoromethyl)anilino]thiourea (PubChem CID 24501812) has the molecular formula C15H12F4N4O2S and a molecular weight of 388.35 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[2-nitro-4-(trifluoromethyl)anilino]thiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[2-nitro-4-(trifluoromethyl)anilino]thiourea |
|---|---|
| PubChem CID | 24501812 |
| Molecular Formula | C15H12F4N4O2S |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[2-nitro-4-(trifluoromethyl)anilino]thiourea |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1NNC(=S)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C15H12F4N4O2S/c16-11-4-1-9(2-5-11)8-20-14(26)22-21-12-6-3-10(15(17,18)19)7-13(12)23(24)25/h1-7,21H,8H2,(H2,20,22,26) |
| InChIKey | XXWKNUTVWLHZMV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|