C11H14F3N3O2 — CID 118902581
tert-butyl N-[4-amino-2-(trifluoromethyl)-3-pyridinyl]carbamate (PubChem CID 118902581) has the molecular formula C11H14F3N3O2 and a molecular weight of 277.25 g/mol. Its IUPAC name is tert-butyl N-[4-amino-2-(trifluoromethyl)-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[4-amino-2-(trifluoromethyl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 118902581 |
| Molecular Formula | C11H14F3N3O2 |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | tert-butyl N-[4-amino-2-(trifluoromethyl)-3-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1c(N)ccnc1C(F)(F)F |
| InChI | InChI=1S/C11H14F3N3O2/c1-10(2,3)19-9(18)17-7-6(15)4-5-16-8(7)11(12,13)14/h4-5H,1-3H3,(H2,15,16)(H,17,18) |
| InChIKey | WIDNAKQCFRQNOH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |