C10H15N3O3 — CID 83854419
tert-butyl N-[4-(hydroxymethyl)pyrimidin-2-yl]carbamate (PubChem CID 83854419) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is tert-butyl N-[4-(hydroxymethyl)pyrimidin-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-(hydroxymethyl)pyrimidin-2-yl]carbamate |
|---|---|
| PubChem CID | 83854419 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | tert-butyl N-[4-(hydroxymethyl)pyrimidin-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nccc(CO)n1 |
| InChI | InChI=1S/C10H15N3O3/c1-10(2,3)16-9(15)13-8-11-5-4-7(6-14)12-8/h4-5,14H,6H2,1-3H3,(H,11,12,13,15) |
| InChIKey | VYYMSLBQLGZGGA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |