C16H29N3O2 — CID 114702676
tert-butyl N-[2-(3-pentylimidazol-4-yl)propan-2-yl]carbamate (PubChem CID 114702676) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is tert-butyl N-[2-(3-pentylimidazol-4-yl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-(3-pentylimidazol-4-yl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 114702676 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | tert-butyl N-[2-(3-pentylimidazol-4-yl)propan-2-yl]carbamate |
| SMILES | CCCCCn1cncc1C(C)(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H29N3O2/c1-7-8-9-10-19-12-17-11-13(19)16(5,6)18-14(20)21-15(2,3)4/h11-12H,7-10H2,1-6H3,(H,18,20) |
| InChIKey | AEDBBHQJBRZPSN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|