C12H21N3O2 — CID 114703715
tert-butyl N-[2-(3-methylimidazol-4-yl)propan-2-yl]carbamate (PubChem CID 114703715) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is tert-butyl N-[2-(3-methylimidazol-4-yl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-(3-methylimidazol-4-yl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 114703715 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | tert-butyl N-[2-(3-methylimidazol-4-yl)propan-2-yl]carbamate |
| SMILES | Cn1cncc1C(C)(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H21N3O2/c1-11(2,3)17-10(16)14-12(4,5)9-7-13-8-15(9)6/h7-8H,1-6H3,(H,14,16) |
| InChIKey | IRXVUBRCNIABIB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |