C17H20N4O4 — CID 121284076
tert-butyl N-[2-[6-(2-formyl-4-pyridinyl)pyrazin-2-yl]oxyethyl]carbamate (PubChem CID 121284076) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is tert-butyl N-[2-[6-(2-formyl-4-pyridinyl)pyrazin-2-yl]oxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-[6-(2-formyl-4-pyridinyl)pyrazin-2-yl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 121284076 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | tert-butyl N-[2-[6-(2-formyl-4-pyridinyl)pyrazin-2-yl]oxyethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1cncc(-c2ccnc(C=O)c2)n1 |
| InChI | InChI=1S/C17H20N4O4/c1-17(2,3)25-16(23)20-6-7-24-15-10-18-9-14(21-15)12-4-5-19-13(8-12)11-22/h4-5,8-11H,6-7H2,1-3H3,(H,20,23) |
| InChIKey | SKNXCYDWWPLCFR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|