C18H30F2N4O3 — CID 146503843
tert-butyl N-[5-amino-2-(2,2-difluoroethoxy)-4-[2-(dimethylamino)ethyl-methylamino]phenyl]carbamate (PubChem CID 146503843) has the molecular formula C18H30F2N4O3 and a molecular weight of 388.46 g/mol. Its IUPAC name is tert-butyl N-[5-amino-2-(2,2-difluoroethoxy)-4-[2-(dimethylamino)ethyl-methylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[5-amino-2-(2,2-difluoroethoxy)-4-[2-(dimethylamino)ethyl-methylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 146503843 |
| Molecular Formula | C18H30F2N4O3 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | tert-butyl N-[5-amino-2-(2,2-difluoroethoxy)-4-[2-(dimethylamino)ethyl-methylamino]phenyl]carbamate |
| SMILES | CN(C)CCN(C)c1cc(OCC(F)F)c(NC(=O)OC(C)(C)C)cc1N |
| InChI | InChI=1S/C18H30F2N4O3/c1-18(2,3)27-17(25)22-13-9-12(21)14(24(6)8-7-23(4)5)10-15(13)26-11-16(19)20/h9-10,16H,7-8,11,21H2,1-6H3,(H,22,25) |
| InChIKey | DZHZPGKVXDSQAE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|