C17H24F4N4O4 — CID 174239933
N-[5-amino-2-[2-(dimethylamino)ethyl-methylamino]-4-methoxyphenyl]-2-fluoroprop-2-enamide;2,2,2-trifluoroacetic acid (PubChem CID 174239933) has the molecular formula C17H24F4N4O4 and a molecular weight of 424.40 g/mol. Its IUPAC name is N-[5-amino-2-[2-(dimethylamino)ethyl-methylamino]-4-methoxyphenyl]-2-fluoroprop-2-enamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[5-amino-2-[2-(dimethylamino)ethyl-methylamino]-4-methoxyphenyl]-2-fluoroprop-2-enamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 174239933 |
| Molecular Formula | C17H24F4N4O4 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N-[5-amino-2-[2-(dimethylamino)ethyl-methylamino]-4-methoxyphenyl]-2-fluoroprop-2-enamide;2,2,2-trifluoroacetic acid |
| SMILES | C=C(F)C(=O)Nc1cc(N)c(OC)cc1N(C)CCN(C)C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23FN4O2.C2HF3O2/c1-10(16)15(21)18-12-8-11(17)14(22-5)9-13(12)20(4)7-6-19(2)3;3-2(4,5)1(6)7/h8-9H,1,6-7,17H2,2-5H3,(H,18,21);(H,6,7) |
| InChIKey | AVAINUOLKNJSJZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|