C14H21N3O4 — CID 155150487
methyl 3-(5-acetamido-4-amino-2-methoxy-N-methylanilino)propanoate (PubChem CID 155150487) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is methyl 3-(5-acetamido-4-amino-2-methoxy-N-methylanilino)propanoate.
| Compound Name | methyl 3-(5-acetamido-4-amino-2-methoxy-N-methylanilino)propanoate |
|---|---|
| PubChem CID | 155150487 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | methyl 3-(5-acetamido-4-amino-2-methoxy-N-methylanilino)propanoate |
| SMILES | COC(=O)CCN(C)c1cc(NC(C)=O)c(N)cc1OC |
| InChI | InChI=1S/C14H21N3O4/c1-9(18)16-11-8-12(13(20-3)7-10(11)15)17(2)6-5-14(19)21-4/h7-8H,5-6,15H2,1-4H3,(H,16,18) |
| InChIKey | IWFKXEIDFJWXGG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|