C16H23N3O7 — CID 167055796
[2-amino-5-[bis(3-methoxy-3-oxopropyl)amino]-4-methoxyphenyl]carbamic acid (PubChem CID 167055796) has the molecular formula C16H23N3O7 and a molecular weight of 369.37 g/mol. Its IUPAC name is [2-amino-5-[bis(3-methoxy-3-oxopropyl)amino]-4-methoxyphenyl]carbamic acid.
| Compound Name | [2-amino-5-[bis(3-methoxy-3-oxopropyl)amino]-4-methoxyphenyl]carbamic acid |
|---|---|
| PubChem CID | 167055796 |
| Molecular Formula | C16H23N3O7 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | [2-amino-5-[bis(3-methoxy-3-oxopropyl)amino]-4-methoxyphenyl]carbamic acid |
| SMILES | COC(=O)CCN(CCC(=O)OC)c1cc(NC(=O)O)c(N)cc1OC |
| InChI | InChI=1S/C16H23N3O7/c1-24-13-8-10(17)11(18-16(22)23)9-12(13)19(6-4-14(20)25-2)7-5-15(21)26-3/h8-9,18H,4-7,17H2,1-3H3,(H,22,23) |
| InChIKey | JWPKKZIVSUEJDC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 140.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|