C23H29N3O5 — CID 155150518
2-oxobutyl 3-(5-acetamido-4-amino-N-benzyl-2-methoxyanilino)propanoate (PubChem CID 155150518) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-oxobutyl 3-(5-acetamido-4-amino-N-benzyl-2-methoxyanilino)propanoate.
| Compound Name | 2-oxobutyl 3-(5-acetamido-4-amino-N-benzyl-2-methoxyanilino)propanoate |
|---|---|
| PubChem CID | 155150518 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 2-oxobutyl 3-(5-acetamido-4-amino-N-benzyl-2-methoxyanilino)propanoate |
| SMILES | CCC(=O)COC(=O)CCN(Cc1ccccc1)c1cc(NC(C)=O)c(N)cc1OC |
| InChI | InChI=1S/C23H29N3O5/c1-4-18(28)15-31-23(29)10-11-26(14-17-8-6-5-7-9-17)21-13-20(25-16(2)27)19(24)12-22(21)30-3/h5-9,12-13H,4,10-11,14-15,24H2,1-3H3,(H,25,27) |
| InChIKey | MGXGBLBUPUFQLA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|