C13H18ClNO2 — CID 115235517
4-(5-chloro-2-methoxy-N,4-dimethylanilino)butan-2-one (PubChem CID 115235517) has the molecular formula C13H18ClNO2 and a molecular weight of 255.75 g/mol. Its IUPAC name is 4-(5-chloro-2-methoxy-N,4-dimethylanilino)butan-2-one.
| Compound Name | 4-(5-chloro-2-methoxy-N,4-dimethylanilino)butan-2-one |
|---|---|
| PubChem CID | 115235517 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 4-(5-chloro-2-methoxy-N,4-dimethylanilino)butan-2-one |
| SMILES | COc1cc(C)c(Cl)cc1N(C)CCC(C)=O |
| InChI | InChI=1S/C13H18ClNO2/c1-9-7-13(17-4)12(8-11(9)14)15(3)6-5-10(2)16/h7-8H,5-6H2,1-4H3 |
| InChIKey | GDSUNGGZMDWNLO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |