C12H16ClNO2 — CID 115234566
1-(5-chloro-2-methoxy-N,4-dimethylanilino)propan-2-one (PubChem CID 115234566) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxy-N,4-dimethylanilino)propan-2-one.
| Compound Name | 1-(5-chloro-2-methoxy-N,4-dimethylanilino)propan-2-one |
|---|---|
| PubChem CID | 115234566 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 1-(5-chloro-2-methoxy-N,4-dimethylanilino)propan-2-one |
| SMILES | COc1cc(C)c(Cl)cc1N(C)CC(C)=O |
| InChI | InChI=1S/C12H16ClNO2/c1-8-5-12(16-4)11(6-10(8)13)14(3)7-9(2)15/h5-6H,7H2,1-4H3 |
| InChIKey | QNOPPKNBXPZIDQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |