C13H18ClNO2 — CID 115234582
1-(3-chloro-6-methoxy-N,2,4-trimethylanilino)propan-2-one (PubChem CID 115234582) has the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. Its IUPAC name is 1-(3-chloro-6-methoxy-N,2,4-trimethylanilino)propan-2-one.
| Compound Name | 1-(3-chloro-6-methoxy-N,2,4-trimethylanilino)propan-2-one |
|---|---|
| PubChem CID | 115234582 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.74 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 1-(3-chloro-6-methoxy-N,2,4-trimethylanilino)propan-2-one |
| SMILES | COc1cc(C)c(Cl)c(C)c1N(C)CC(C)=O |
| InChI | InChI=1S/C13H18ClNO2/c1-8-6-11(17-5)13(10(3)12(8)14)15(4)7-9(2)16/h6H,7H2,1-5H3 |
| InChIKey | OKEAYVNERIAJDT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.74 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |