C12H18ClNO2 — CID 115258379
3-chloro-6-methoxy-N-(methoxymethyl)-N,2,4-trimethylaniline (PubChem CID 115258379) has the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. Its IUPAC name is 3-chloro-6-methoxy-N-(methoxymethyl)-N,2,4-trimethylaniline.
| Compound Name | 3-chloro-6-methoxy-N-(methoxymethyl)-N,2,4-trimethylaniline |
|---|---|
| PubChem CID | 115258379 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 3-chloro-6-methoxy-N-(methoxymethyl)-N,2,4-trimethylaniline |
| SMILES | COCN(C)c1c(OC)cc(C)c(Cl)c1C |
| InChI | InChI=1S/C12H18ClNO2/c1-8-6-10(16-5)12(9(2)11(8)13)14(3)7-15-4/h6H,7H2,1-5H3 |
| InChIKey | ZMSALKOQQKNQMQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|