C12H15ClO2 — CID 116863468
2-(3-chloro-6-methoxy-2,4-dimethylphenyl)-3-methyloxirane (PubChem CID 116863468) has the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. Its IUPAC name is 2-(3-chloro-6-methoxy-2,4-dimethylphenyl)-3-methyloxirane.
| Compound Name | 2-(3-chloro-6-methoxy-2,4-dimethylphenyl)-3-methyloxirane |
|---|---|
| PubChem CID | 116863468 |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.70 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-(3-chloro-6-methoxy-2,4-dimethylphenyl)-3-methyloxirane |
| SMILES | COc1cc(C)c(Cl)c(C)c1C1OC1C |
| InChI | InChI=1S/C12H15ClO2/c1-6-5-9(14-4)10(7(2)11(6)13)12-8(3)15-12/h5,8,12H,1-4H3 |
| InChIKey | BISDFCKJVMNZPE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.70 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|