C11H12ClNO3 — CID 116924450
2-(3-chloro-6-methoxy-2,4-dimethylphenyl)-2-oxoacetamide (PubChem CID 116924450) has the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. Its IUPAC name is 2-(3-chloro-6-methoxy-2,4-dimethylphenyl)-2-oxoacetamide.
| Compound Name | 2-(3-chloro-6-methoxy-2,4-dimethylphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 116924450 |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 241.67 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 2-(3-chloro-6-methoxy-2,4-dimethylphenyl)-2-oxoacetamide |
| SMILES | COc1cc(C)c(Cl)c(C)c1C(=O)C(N)=O |
| InChI | InChI=1S/C11H12ClNO3/c1-5-4-7(16-3)8(6(2)9(5)12)10(14)11(13)15/h4H,1-3H3,(H2,13,15) |
| InChIKey | QAKSXJOYGAEEJM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.67 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|