C11H15NO3 — CID 175082400
2,6-dimethoxy-3,4-dimethylbenzamide (PubChem CID 175082400) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 2,6-dimethoxy-3,4-dimethylbenzamide.
| Compound Name | 2,6-dimethoxy-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 175082400 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 2,6-dimethoxy-3,4-dimethylbenzamide |
| SMILES | COc1cc(C)c(C)c(OC)c1C(N)=O |
| InChI | InChI=1S/C11H15NO3/c1-6-5-8(14-3)9(11(12)13)10(15-4)7(6)2/h5H,1-4H3,(H2,12,13) |
| InChIKey | UBYHPVDKOGLTOM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |