2,5-dimethoxy-3,6-dimethylbenzoic acid

C11H14O4 — CID 23538696

IUPAC2,5-dimethoxy-3,6-dimethylbenzoic acid
SMILESCOc1cc(C)c(OC)c(C(=O)O)c1C
InChIInChI=1S/C11H14O4/c1-6-5-8(14-3)7(2)9(11(12)13)10(6)15-4/h5H,1-4H3,(H,12,13)
InChIKeyZRSVIDSMNUEIRL-UHFFFAOYSA-N
MW210.23 g/mol
LogP2.02
Rot. Bonds3

About 2,5-dimethoxy-3,6-dimethylbenzoic acid

2,5-dimethoxy-3,6-dimethylbenzoic acid (PubChem CID 23538696) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2,5-dimethoxy-3,6-dimethylbenzoic acid.

Molecular Properties

Compound Name2,5-dimethoxy-3,6-dimethylbenzoic acid
PubChem CID23538696
Molecular FormulaC11H14O4
Molecular Weight210.23 g/mol
Exact Mass210.09
IUPAC Name2,5-dimethoxy-3,6-dimethylbenzoic acid
SMILESCOc1cc(C)c(OC)c(C(=O)O)c1C
InChIInChI=1S/C11H14O4/c1-6-5-8(14-3)7(2)9(11(12)13)10(6)15-4/h5H,1-4H3,(H,12,13)
InChIKeyZRSVIDSMNUEIRL-UHFFFAOYSA-N
XLogP2.02
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.23
LogP ≤ 52.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2,5-dimethoxy-3,6-dimethylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-dimethoxy-3,6-dimethylbenzoic acid?
The IUPAC name of 2,5-dimethoxy-3,6-dimethylbenzoic acid (CID 23538696) is 2,5-dimethoxy-3,6-dimethylbenzoic acid.
What is the SMILES notation for 2,5-dimethoxy-3,6-dimethylbenzoic acid?
The canonical SMILES for 2,5-dimethoxy-3,6-dimethylbenzoic acid is COc1cc(C)c(OC)c(C(=O)O)c1C.
What is the InChIKey of 2,5-dimethoxy-3,6-dimethylbenzoic acid?
The InChIKey is ZRSVIDSMNUEIRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4/c1-6-5-8(14-3)7(2)9(11(12)13)10(6)15-4/h5H,1-4H3,(H,12,13).
What are the key properties of 2,5-dimethoxy-3,6-dimethylbenzoic acid?
2,5-dimethoxy-3,6-dimethylbenzoic acid has a molecular weight of 210.23 g/mol, XLogP of 2.02, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethoxy-3,6-dimethylbenzoic acid is sourced from PubChem (CID 23538696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).