C11H14O4 — CID 23538696
2,5-dimethoxy-3,6-dimethylbenzoic acid (PubChem CID 23538696) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2,5-dimethoxy-3,6-dimethylbenzoic acid.
| Compound Name | 2,5-dimethoxy-3,6-dimethylbenzoic acid |
|---|---|
| PubChem CID | 23538696 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2,5-dimethoxy-3,6-dimethylbenzoic acid |
| SMILES | COc1cc(C)c(OC)c(C(=O)O)c1C |
| InChI | InChI=1S/C11H14O4/c1-6-5-8(14-3)7(2)9(11(12)13)10(6)15-4/h5H,1-4H3,(H,12,13) |
| InChIKey | ZRSVIDSMNUEIRL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |