C11H15O3P — CID 159041821
(2,6-dimethoxy-3,5-dimethylphenyl)-phosphanylmethanone (PubChem CID 159041821) has the molecular formula C11H15O3P and a molecular weight of 226.21 g/mol. Its IUPAC name is (2,6-dimethoxy-3,5-dimethylphenyl)-phosphanylmethanone.
| Compound Name | (2,6-dimethoxy-3,5-dimethylphenyl)-phosphanylmethanone |
|---|---|
| PubChem CID | 159041821 |
| Molecular Formula | C11H15O3P |
| Molecular Weight | 226.21 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | (2,6-dimethoxy-3,5-dimethylphenyl)-phosphanylmethanone |
| SMILES | COc1c(C)cc(C)c(OC)c1C(=O)P |
| InChI | InChI=1S/C11H15O3P/c1-6-5-7(2)10(14-4)8(11(12)15)9(6)13-3/h5H,15H2,1-4H3 |
| InChIKey | PQYIXXMVAGTARC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|