About (2,6-dimethoxy-3,5-dimethylphenyl)-ethylphosphanylmethanone
(2,6-dimethoxy-3,5-dimethylphenyl)-ethylphosphanylmethanone (PubChem CID 87923708) has the molecular formula C13H19O3P
and a molecular weight of 254.27 g/mol. Its IUPAC name is (2,6-dimethoxy-3,5-dimethylphenyl)-ethylphosphanylmethanone.
Molecular Properties
| Compound Name | (2,6-dimethoxy-3,5-dimethylphenyl)-ethylphosphanylmethanone |
| PubChem CID | 87923708 |
| Molecular Formula | C13H19O3P |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (2,6-dimethoxy-3,5-dimethylphenyl)-ethylphosphanylmethanone |
| SMILES | CCPC(=O)c1c(OC)c(C)cc(C)c1OC |
| InChI | InChI=1S/C13H19O3P/c1-6-17-13(14)10-11(15-4)8(2)7-9(3)12(10)16-5/h7,17H,6H2,1-5H3 |
| InChIKey | IXUDYGQZLGRHEA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2,6-dimethoxy-3,5-dimethylphenyl)-ethylphosphanylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dimethoxy-3,5-dimethylphenyl)-ethylphosphanylmethanone?
The IUPAC name of (2,6-dimethoxy-3,5-dimethylphenyl)-ethylphosphanylmethanone (CID 87923708) is (2,6-dimethoxy-3,5-dimethylphenyl)-ethylphosphanylmethanone.
What is the SMILES notation for (2,6-dimethoxy-3,5-dimethylphenyl)-ethylphosphanylmethanone?
The canonical SMILES for (2,6-dimethoxy-3,5-dimethylphenyl)-ethylphosphanylmethanone is CCPC(=O)c1c(OC)c(C)cc(C)c1OC.
What is the InChIKey of (2,6-dimethoxy-3,5-dimethylphenyl)-ethylphosphanylmethanone?
The InChIKey is IXUDYGQZLGRHEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19O3P/c1-6-17-13(14)10-11(15-4)8(2)7-9(3)12(10)16-5/h7,17H,6H2,1-5H3.
What are the key properties of (2,6-dimethoxy-3,5-dimethylphenyl)-ethylphosphanylmethanone?
(2,6-dimethoxy-3,5-dimethylphenyl)-ethylphosphanylmethanone has a molecular weight of 254.27 g/mol, XLogP of 3.16, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethoxy-3,5-dimethylphenyl)-ethylphosphanylmethanone is sourced from PubChem (CID 87923708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).