C13H18LiO3P — CID 141022821
lithium [3-(2,6-dimethoxy-3,5-dimethylphenyl)-3-oxopropyl]phosphanide (PubChem CID 141022821) has the molecular formula C13H18LiO3P and a molecular weight of 260.20 g/mol. Its IUPAC name is lithium [3-(2,6-dimethoxy-3,5-dimethylphenyl)-3-oxopropyl]phosphanide.
| Compound Name | lithium [3-(2,6-dimethoxy-3,5-dimethylphenyl)-3-oxopropyl]phosphanide |
|---|---|
| PubChem CID | 141022821 |
| Molecular Formula | C13H18LiO3P |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | lithium [3-(2,6-dimethoxy-3,5-dimethylphenyl)-3-oxopropyl]phosphanide |
| SMILES | COc1c(C)cc(C)c(OC)c1C(=O)CC[PH-].[Li+] |
| InChI | InChI=1S/C13H18O3P.Li/c1-8-7-9(2)13(16-4)11(12(8)15-3)10(14)5-6-17;/h7,17H,5-6H2,1-4H3;/q-1;+1 |
| InChIKey | GTONLRPFZKRJJF-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|