C11H13ClO2 — CID 116924656
2-methoxy-3,4,6-trimethylbenzoyl chloride (PubChem CID 116924656) has the molecular formula C11H13ClO2 and a molecular weight of 212.68 g/mol. Its IUPAC name is 2-methoxy-3,4,6-trimethylbenzoyl chloride.
| Compound Name | 2-methoxy-3,4,6-trimethylbenzoyl chloride |
|---|---|
| PubChem CID | 116924656 |
| Molecular Formula | C11H13ClO2 |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 2-methoxy-3,4,6-trimethylbenzoyl chloride |
| SMILES | COc1c(C)c(C)cc(C)c1C(=O)Cl |
| InChI | InChI=1S/C11H13ClO2/c1-6-5-7(2)9(11(12)13)10(14-4)8(6)3/h5H,1-4H3 |
| InChIKey | WUWBDQNACUYDIY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|