C12H16O2S — CID 116829931
1-(4-methoxy-2,3,6-trimethylphenyl)-2-sulfanylethanone (PubChem CID 116829931) has the molecular formula C12H16O2S and a molecular weight of 224.32 g/mol. Its IUPAC name is 1-(4-methoxy-2,3,6-trimethylphenyl)-2-sulfanylethanone.
| Compound Name | 1-(4-methoxy-2,3,6-trimethylphenyl)-2-sulfanylethanone |
|---|---|
| PubChem CID | 116829931 |
| Molecular Formula | C12H16O2S |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 1-(4-methoxy-2,3,6-trimethylphenyl)-2-sulfanylethanone |
| SMILES | COc1cc(C)c(C(=O)CS)c(C)c1C |
| InChI | InChI=1S/C12H16O2S/c1-7-5-11(14-4)8(2)9(3)12(7)10(13)6-15/h5,15H,6H2,1-4H3 |
| InChIKey | LNTZUZXNPVMCLC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|