methyl 4-(4-ethoxy-2,3,6-trimethylphenyl)-4-oxobutanoate

C16H22O4 — CID 82552629

IUPACmethyl 4-(4-ethoxy-2,3,6-trimethylphenyl)-4-oxobutanoate
SMILESCCOc1cc(C)c(C(=O)CCC(=O)OC)c(C)c1C
InChIInChI=1S/C16H22O4/c1-6-20-14-9-10(2)16(12(4)11(14)3)13(17)7-8-15(18)19-5/h9H,6-8H2,1-5H3
InChIKeyPWDXEQKMDBKYEZ-UHFFFAOYSA-N
MW278.35 g/mol
LogP3.15
Rot. Bonds6

About methyl 4-(4-ethoxy-2,3,6-trimethylphenyl)-4-oxobutanoate

methyl 4-(4-ethoxy-2,3,6-trimethylphenyl)-4-oxobutanoate (PubChem CID 82552629) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is methyl 4-(4-ethoxy-2,3,6-trimethylphenyl)-4-oxobutanoate.

Molecular Properties

Compound Namemethyl 4-(4-ethoxy-2,3,6-trimethylphenyl)-4-oxobutanoate
PubChem CID82552629
Molecular FormulaC16H22O4
Molecular Weight278.35 g/mol
Exact Mass278.15
IUPAC Namemethyl 4-(4-ethoxy-2,3,6-trimethylphenyl)-4-oxobutanoate
SMILESCCOc1cc(C)c(C(=O)CCC(=O)OC)c(C)c1C
InChIInChI=1S/C16H22O4/c1-6-20-14-9-10(2)16(12(4)11(14)3)13(17)7-8-15(18)19-5/h9H,6-8H2,1-5H3
InChIKeyPWDXEQKMDBKYEZ-UHFFFAOYSA-N
XLogP3.15
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.35
LogP ≤ 53.15
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 4-(4-ethoxy-2,3,6-trimethylphenyl)-4-oxobutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(4-ethoxy-2,3,6-trimethylphenyl)-4-oxobutanoate?
The IUPAC name of methyl 4-(4-ethoxy-2,3,6-trimethylphenyl)-4-oxobutanoate (CID 82552629) is methyl 4-(4-ethoxy-2,3,6-trimethylphenyl)-4-oxobutanoate.
What is the SMILES notation for methyl 4-(4-ethoxy-2,3,6-trimethylphenyl)-4-oxobutanoate?
The canonical SMILES for methyl 4-(4-ethoxy-2,3,6-trimethylphenyl)-4-oxobutanoate is CCOc1cc(C)c(C(=O)CCC(=O)OC)c(C)c1C.
What is the InChIKey of methyl 4-(4-ethoxy-2,3,6-trimethylphenyl)-4-oxobutanoate?
The InChIKey is PWDXEQKMDBKYEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O4/c1-6-20-14-9-10(2)16(12(4)11(14)3)13(17)7-8-15(18)19-5/h9H,6-8H2,1-5H3.
What are the key properties of methyl 4-(4-ethoxy-2,3,6-trimethylphenyl)-4-oxobutanoate?
methyl 4-(4-ethoxy-2,3,6-trimethylphenyl)-4-oxobutanoate has a molecular weight of 278.35 g/mol, XLogP of 3.15, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(4-ethoxy-2,3,6-trimethylphenyl)-4-oxobutanoate is sourced from PubChem (CID 82552629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).