C11H12O6 — CID 96710199
methyl 4-oxo-4-(2,4,6-trihydroxyphenyl)butanoate (PubChem CID 96710199) has the molecular formula C11H12O6 and a molecular weight of 240.21 g/mol. Its IUPAC name is methyl 4-oxo-4-(2,4,6-trihydroxyphenyl)butanoate.
| Compound Name | methyl 4-oxo-4-(2,4,6-trihydroxyphenyl)butanoate |
|---|---|
| PubChem CID | 96710199 |
| Molecular Formula | C11H12O6 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | methyl 4-oxo-4-(2,4,6-trihydroxyphenyl)butanoate |
| SMILES | COC(=O)CCC(=O)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C11H12O6/c1-17-10(16)3-2-7(13)11-8(14)4-6(12)5-9(11)15/h4-5,12,14-15H,2-3H2,1H3 |
| InChIKey | DEEYTAOQBKVYAN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |