C14H19ClO2 — CID 82266293
2-chloro-1-(2,3,6-trimethyl-4-propan-2-yloxyphenyl)ethanone (PubChem CID 82266293) has the molecular formula C14H19ClO2 and a molecular weight of 254.76 g/mol. Its IUPAC name is 2-chloro-1-(2,3,6-trimethyl-4-propan-2-yloxyphenyl)ethanone.
| Compound Name | 2-chloro-1-(2,3,6-trimethyl-4-propan-2-yloxyphenyl)ethanone |
|---|---|
| PubChem CID | 82266293 |
| Molecular Formula | C14H19ClO2 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-chloro-1-(2,3,6-trimethyl-4-propan-2-yloxyphenyl)ethanone |
| SMILES | Cc1cc(OC(C)C)c(C)c(C)c1C(=O)CCl |
| InChI | InChI=1S/C14H19ClO2/c1-8(2)17-13-6-9(3)14(12(16)7-15)11(5)10(13)4/h6,8H,7H2,1-5H3 |
| InChIKey | QYUIVFPRJYXWHT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|