About ethyl 2-(3-chloro-2,4-dimethyl-6-propan-2-yloxyphenyl)acetate
ethyl 2-(3-chloro-2,4-dimethyl-6-propan-2-yloxyphenyl)acetate (PubChem CID 82553188) has the molecular formula C15H21ClO3
and a molecular weight of 284.78 g/mol. Its IUPAC name is ethyl 2-(3-chloro-2,4-dimethyl-6-propan-2-yloxyphenyl)acetate.
Analyze ethyl 2-(3-chloro-2,4-dimethyl-6-propan-2-yloxyphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(3-chloro-2,4-dimethyl-6-propan-2-yloxyphenyl)acetate?
The IUPAC name of ethyl 2-(3-chloro-2,4-dimethyl-6-propan-2-yloxyphenyl)acetate (CID 82553188) is ethyl 2-(3-chloro-2,4-dimethyl-6-propan-2-yloxyphenyl)acetate.
What is the SMILES notation for ethyl 2-(3-chloro-2,4-dimethyl-6-propan-2-yloxyphenyl)acetate?
The canonical SMILES for ethyl 2-(3-chloro-2,4-dimethyl-6-propan-2-yloxyphenyl)acetate is CCOC(=O)Cc1c(OC(C)C)cc(C)c(Cl)c1C.
What is the InChIKey of ethyl 2-(3-chloro-2,4-dimethyl-6-propan-2-yloxyphenyl)acetate?
The InChIKey is DXJDZHGFTDDVJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21ClO3/c1-6-18-14(17)8-12-11(5)15(16)10(4)7-13(12)19-9(2)3/h7,9H,6,8H2,1-5H3.
What are the key properties of ethyl 2-(3-chloro-2,4-dimethyl-6-propan-2-yloxyphenyl)acetate?
ethyl 2-(3-chloro-2,4-dimethyl-6-propan-2-yloxyphenyl)acetate has a molecular weight of 284.78 g/mol, XLogP of 3.85, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(3-chloro-2,4-dimethyl-6-propan-2-yloxyphenyl)acetate is sourced from PubChem (CID 82553188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).