C18H20ClNO2 — CID 82265287
(4-aminophenyl)-(3-chloro-2,4-dimethyl-6-propan-2-yloxyphenyl)methanone (PubChem CID 82265287) has the molecular formula C18H20ClNO2 and a molecular weight of 317.82 g/mol. Its IUPAC name is (4-aminophenyl)-(3-chloro-2,4-dimethyl-6-propan-2-yloxyphenyl)methanone.
| Compound Name | (4-aminophenyl)-(3-chloro-2,4-dimethyl-6-propan-2-yloxyphenyl)methanone |
|---|---|
| PubChem CID | 82265287 |
| Molecular Formula | C18H20ClNO2 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (4-aminophenyl)-(3-chloro-2,4-dimethyl-6-propan-2-yloxyphenyl)methanone |
| SMILES | Cc1cc(OC(C)C)c(C(=O)c2ccc(N)cc2)c(C)c1Cl |
| InChI | InChI=1S/C18H20ClNO2/c1-10(2)22-15-9-11(3)17(19)12(4)16(15)18(21)13-5-7-14(20)8-6-13/h5-10H,20H2,1-4H3 |
| InChIKey | AQGVLLXCKCWZNW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|