C16H19ClO4 — CID 82553184
methyl (E)-4-(3-chloro-2,4-dimethyl-6-propan-2-yloxyphenyl)-4-oxobut-2-enoate (PubChem CID 82553184) has the molecular formula C16H19ClO4 and a molecular weight of 310.78 g/mol. Its IUPAC name is methyl (E)-4-(3-chloro-2,4-dimethyl-6-propan-2-yloxyphenyl)-4-oxobut-2-enoate.
| Compound Name | methyl (E)-4-(3-chloro-2,4-dimethyl-6-propan-2-yloxyphenyl)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 82553184 |
| Molecular Formula | C16H19ClO4 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | methyl (E)-4-(3-chloro-2,4-dimethyl-6-propan-2-yloxyphenyl)-4-oxobut-2-enoate |
| SMILES | COC(=O)/C=C/C(=O)c1c(OC(C)C)cc(C)c(Cl)c1C |
| InChI | InChI=1S/C16H19ClO4/c1-9(2)21-13-8-10(3)16(17)11(4)15(13)12(18)6-7-14(19)20-5/h6-9H,1-5H3/b7-6+ |
| InChIKey | YGRRBQQUCHHGEQ-VOTSOKGWSA-N |
| XLogP | 3.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|