methyl (E)-4-(3-chloro-2,4,6-trimethylphenyl)-4-oxobut-2-enoate

C14H15ClO3 — CID 82551005

IUPACmethyl (E)-4-(3-chloro-2,4,6-trimethylphenyl)-4-oxobut-2-enoate
SMILESCOC(=O)/C=C/C(=O)c1c(C)cc(C)c(Cl)c1C
InChIInChI=1S/C14H15ClO3/c1-8-7-9(2)14(15)10(3)13(8)11(16)5-6-12(17)18-4/h5-7H,1-4H3/b6-5+
InChIKeyRBNXFCACOTVXDM-AATRIKPKSA-N
MW266.72 g/mol
LogP3.18
Rot. Bonds3

About methyl (E)-4-(3-chloro-2,4,6-trimethylphenyl)-4-oxobut-2-enoate

methyl (E)-4-(3-chloro-2,4,6-trimethylphenyl)-4-oxobut-2-enoate (PubChem CID 82551005) has the molecular formula C14H15ClO3 and a molecular weight of 266.72 g/mol. Its IUPAC name is methyl (E)-4-(3-chloro-2,4,6-trimethylphenyl)-4-oxobut-2-enoate.

Molecular Properties

Compound Namemethyl (E)-4-(3-chloro-2,4,6-trimethylphenyl)-4-oxobut-2-enoate
PubChem CID82551005
Molecular FormulaC14H15ClO3
Molecular Weight266.72 g/mol
Exact Mass266.07
IUPAC Namemethyl (E)-4-(3-chloro-2,4,6-trimethylphenyl)-4-oxobut-2-enoate
SMILESCOC(=O)/C=C/C(=O)c1c(C)cc(C)c(Cl)c1C
InChIInChI=1S/C14H15ClO3/c1-8-7-9(2)14(15)10(3)13(8)11(16)5-6-12(17)18-4/h5-7H,1-4H3/b6-5+
InChIKeyRBNXFCACOTVXDM-AATRIKPKSA-N
XLogP3.18
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.72
LogP ≤ 53.18
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl (E)-4-(3-chloro-2,4,6-trimethylphenyl)-4-oxobut-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (E)-4-(3-chloro-2,4,6-trimethylphenyl)-4-oxobut-2-enoate?
The IUPAC name of methyl (E)-4-(3-chloro-2,4,6-trimethylphenyl)-4-oxobut-2-enoate (CID 82551005) is methyl (E)-4-(3-chloro-2,4,6-trimethylphenyl)-4-oxobut-2-enoate.
What is the SMILES notation for methyl (E)-4-(3-chloro-2,4,6-trimethylphenyl)-4-oxobut-2-enoate?
The canonical SMILES for methyl (E)-4-(3-chloro-2,4,6-trimethylphenyl)-4-oxobut-2-enoate is COC(=O)/C=C/C(=O)c1c(C)cc(C)c(Cl)c1C.
What is the InChIKey of methyl (E)-4-(3-chloro-2,4,6-trimethylphenyl)-4-oxobut-2-enoate?
The InChIKey is RBNXFCACOTVXDM-AATRIKPKSA-N. The full InChI is InChI=1S/C14H15ClO3/c1-8-7-9(2)14(15)10(3)13(8)11(16)5-6-12(17)18-4/h5-7H,1-4H3/b6-5+.
What are the key properties of methyl (E)-4-(3-chloro-2,4,6-trimethylphenyl)-4-oxobut-2-enoate?
methyl (E)-4-(3-chloro-2,4,6-trimethylphenyl)-4-oxobut-2-enoate has a molecular weight of 266.72 g/mol, XLogP of 3.18, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-4-(3-chloro-2,4,6-trimethylphenyl)-4-oxobut-2-enoate is sourced from PubChem (CID 82551005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).