C14H15ClO3 — CID 82551005
methyl (E)-4-(3-chloro-2,4,6-trimethylphenyl)-4-oxobut-2-enoate (PubChem CID 82551005) has the molecular formula C14H15ClO3 and a molecular weight of 266.72 g/mol. Its IUPAC name is methyl (E)-4-(3-chloro-2,4,6-trimethylphenyl)-4-oxobut-2-enoate.
| Compound Name | methyl (E)-4-(3-chloro-2,4,6-trimethylphenyl)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 82551005 |
| Molecular Formula | C14H15ClO3 |
| Molecular Weight | 266.72 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | methyl (E)-4-(3-chloro-2,4,6-trimethylphenyl)-4-oxobut-2-enoate |
| SMILES | COC(=O)/C=C/C(=O)c1c(C)cc(C)c(Cl)c1C |
| InChI | InChI=1S/C14H15ClO3/c1-8-7-9(2)14(15)10(3)13(8)11(16)5-6-12(17)18-4/h5-7H,1-4H3/b6-5+ |
| InChIKey | RBNXFCACOTVXDM-AATRIKPKSA-N |
| XLogP | 3.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.72 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|