C12H13ClO3 — CID 82292853
2-(3-chloro-6-methoxy-2,4-dimethylphenyl)prop-2-enoic acid (PubChem CID 82292853) has the molecular formula C12H13ClO3 and a molecular weight of 240.69 g/mol. Its IUPAC name is 2-(3-chloro-6-methoxy-2,4-dimethylphenyl)prop-2-enoic acid.
| Compound Name | 2-(3-chloro-6-methoxy-2,4-dimethylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 82292853 |
| Molecular Formula | C12H13ClO3 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 2-(3-chloro-6-methoxy-2,4-dimethylphenyl)prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1c(OC)cc(C)c(Cl)c1C |
| InChI | InChI=1S/C12H13ClO3/c1-6-5-9(16-4)10(7(2)11(6)13)8(3)12(14)15/h5H,3H2,1-2,4H3,(H,14,15) |
| InChIKey | GVDDWYBJYOIOHO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|