C18H20N2O6 — CID 134489407
methyl (Z)-4-[4-[[(Z)-4-methoxy-4-oxobut-2-enoyl]amino]-2,3-dimethylanilino]-4-oxobut-2-enoate (PubChem CID 134489407) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is methyl (Z)-4-[4-[[(Z)-4-methoxy-4-oxobut-2-enoyl]amino]-2,3-dimethylanilino]-4-oxobut-2-enoate.
| Compound Name | methyl (Z)-4-[4-[[(Z)-4-methoxy-4-oxobut-2-enoyl]amino]-2,3-dimethylanilino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 134489407 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | methyl (Z)-4-[4-[[(Z)-4-methoxy-4-oxobut-2-enoyl]amino]-2,3-dimethylanilino]-4-oxobut-2-enoate |
| SMILES | COC(=O)/C=C\C(=O)Nc1ccc(NC(=O)/C=C\C(=O)OC)c(C)c1C |
| InChI | InChI=1S/C18H20N2O6/c1-11-12(2)14(20-16(22)8-10-18(24)26-4)6-5-13(11)19-15(21)7-9-17(23)25-3/h5-10H,1-4H3,(H,19,21)(H,20,22)/b9-7-,10-8- |
| InChIKey | NXOTUCSAQVUONI-XOHWUJONSA-N |
| XLogP | 1.64 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|