C12H11NO5 — CID 54868437
3-[[(E)-3-carboxyprop-2-enoyl]amino]-2-methylbenzoic acid (PubChem CID 54868437) has the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. Its IUPAC name is 3-[[(E)-3-carboxyprop-2-enoyl]amino]-2-methylbenzoic acid.
| Compound Name | 3-[[(E)-3-carboxyprop-2-enoyl]amino]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 54868437 |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 3-[[(E)-3-carboxyprop-2-enoyl]amino]-2-methylbenzoic acid |
| SMILES | Cc1c(NC(=O)/C=C/C(=O)O)cccc1C(=O)O |
| InChI | InChI=1S/C12H11NO5/c1-7-8(12(17)18)3-2-4-9(7)13-10(14)5-6-11(15)16/h2-6H,1H3,(H,13,14)(H,15,16)(H,17,18)/b6-5+ |
| InChIKey | UZVFGKNKBBMPKA-AATRIKPKSA-N |
| XLogP | 1.27 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|