C14H15NO3 — CID 70492143
(Z)-4-[2-[(Z)-but-2-en-2-yl]anilino]-4-oxobut-2-enoic acid (PubChem CID 70492143) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is (Z)-4-[2-[(Z)-but-2-en-2-yl]anilino]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[2-[(Z)-but-2-en-2-yl]anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 70492143 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | (Z)-4-[2-[(Z)-but-2-en-2-yl]anilino]-4-oxobut-2-enoic acid |
| SMILES | C/C=C(/C)c1ccccc1NC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C14H15NO3/c1-3-10(2)11-6-4-5-7-12(11)15-13(16)8-9-14(17)18/h3-9H,1-2H3,(H,15,16)(H,17,18)/b9-8-,10-3- |
| InChIKey | XQOKZYWOPOSGIW-VRVALFJFSA-N |
| XLogP | 2.69 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|