C13H13NO3 — CID 54218562
4-oxo-4-(2-prop-1-en-2-ylanilino)but-2-enoic acid (PubChem CID 54218562) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 4-oxo-4-(2-prop-1-en-2-ylanilino)but-2-enoic acid.
| Compound Name | 4-oxo-4-(2-prop-1-en-2-ylanilino)but-2-enoic acid |
|---|---|
| PubChem CID | 54218562 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 4-oxo-4-(2-prop-1-en-2-ylanilino)but-2-enoic acid |
| SMILES | C=C(C)c1ccccc1NC(=O)C=CC(=O)O |
| InChI | InChI=1S/C13H13NO3/c1-9(2)10-5-3-4-6-11(10)14-12(15)7-8-13(16)17/h3-8H,1H2,2H3,(H,14,15)(H,16,17) |
| InChIKey | QAXFJEGQIVCVHK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|