C11H10ClNO4 — CID 6241799
methyl (E)-4-(5-chloro-2-hydroxyanilino)-4-oxobut-2-enoate (PubChem CID 6241799) has the molecular formula C11H10ClNO4 and a molecular weight of 255.66 g/mol. Its IUPAC name is methyl (E)-4-(5-chloro-2-hydroxyanilino)-4-oxobut-2-enoate.
| Compound Name | methyl (E)-4-(5-chloro-2-hydroxyanilino)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 6241799 |
| Molecular Formula | C11H10ClNO4 |
| Molecular Weight | 255.66 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | methyl (E)-4-(5-chloro-2-hydroxyanilino)-4-oxobut-2-enoate |
| SMILES | COC(=O)/C=C/C(=O)Nc1cc(Cl)ccc1O |
| InChI | InChI=1S/C11H10ClNO4/c1-17-11(16)5-4-10(15)13-8-6-7(12)2-3-9(8)14/h2-6,14H,1H3,(H,13,15)/b5-4+ |
| InChIKey | MKZFFWJQFHWPAQ-SNAWJCMRSA-N |
| XLogP | 1.71 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.66 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|