C18H11ClF5NO4 — CID 91727764
(2,3,4,5,6-pentafluorophenyl)methyl (E)-4-(5-chloro-2-methoxyanilino)-4-oxobut-2-enoate (PubChem CID 91727764) has the molecular formula C18H11ClF5NO4 and a molecular weight of 435.73 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl (E)-4-(5-chloro-2-methoxyanilino)-4-oxobut-2-enoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl (E)-4-(5-chloro-2-methoxyanilino)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 91727764 |
| Molecular Formula | C18H11ClF5NO4 |
| Molecular Weight | 435.73 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl (E)-4-(5-chloro-2-methoxyanilino)-4-oxobut-2-enoate |
| SMILES | COc1ccc(Cl)cc1NC(=O)/C=C/C(=O)OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H11ClF5NO4/c1-28-11-3-2-8(19)6-10(11)25-12(26)4-5-13(27)29-7-9-14(20)16(22)18(24)17(23)15(9)21/h2-6H,7H2,1H3,(H,25,26)/b5-4+ |
| InChIKey | VTZGYPOXVRDXHN-SNAWJCMRSA-N |
| XLogP | 4.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.73 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|