About sodium;hydride;methyl 4-(4-aminoanilino)-4-oxobut-2-enoate
sodium;hydride;methyl 4-(4-aminoanilino)-4-oxobut-2-enoate (PubChem CID 174970196) has the molecular formula C11H13N2NaO3
and a molecular weight of 244.23 g/mol. Its IUPAC name is sodium;hydride;methyl 4-(4-aminoanilino)-4-oxobut-2-enoate.
Molecular Properties
| Compound Name | sodium;hydride;methyl 4-(4-aminoanilino)-4-oxobut-2-enoate |
| PubChem CID | 174970196 |
| Molecular Formula | C11H13N2NaO3 |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | sodium;hydride;methyl 4-(4-aminoanilino)-4-oxobut-2-enoate |
| SMILES | COC(=O)C=CC(=O)Nc1ccc(N)cc1.[H-].[Na+] |
| InChI | InChI=1S/C11H12N2O3.Na.H/c1-16-11(15)7-6-10(14)13-9-4-2-8(12)3-5-9;;/h2-7H,12H2,1H3,(H,13,14);;/q;+1;-1 |
| InChIKey | QQGNUZZBUKJJOX-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;methyl 4-(4-aminoanilino)-4-oxobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;methyl 4-(4-aminoanilino)-4-oxobut-2-enoate?
The IUPAC name of sodium;hydride;methyl 4-(4-aminoanilino)-4-oxobut-2-enoate (CID 174970196) is sodium;hydride;methyl 4-(4-aminoanilino)-4-oxobut-2-enoate.
What is the SMILES notation for sodium;hydride;methyl 4-(4-aminoanilino)-4-oxobut-2-enoate?
The canonical SMILES for sodium;hydride;methyl 4-(4-aminoanilino)-4-oxobut-2-enoate is COC(=O)C=CC(=O)Nc1ccc(N)cc1.[H-].[Na+].
What is the InChIKey of sodium;hydride;methyl 4-(4-aminoanilino)-4-oxobut-2-enoate?
The InChIKey is QQGNUZZBUKJJOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3.Na.H/c1-16-11(15)7-6-10(14)13-9-4-2-8(12)3-5-9;;/h2-7H,12H2,1H3,(H,13,14);;/q;+1;-1.
What are the key properties of sodium;hydride;methyl 4-(4-aminoanilino)-4-oxobut-2-enoate?
sodium;hydride;methyl 4-(4-aminoanilino)-4-oxobut-2-enoate has a molecular weight of 244.23 g/mol, XLogP of -1.95, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;methyl 4-(4-aminoanilino)-4-oxobut-2-enoate is sourced from PubChem (CID 174970196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).