C16H22N4O3 — CID 144517855
(Z)-4-[(3-amino-2-methoxypropyl)amino]-N-(4-aminophenyl)-4-(oxiran-2-ylidene)but-2-enamide (PubChem CID 144517855) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is (Z)-4-[(3-amino-2-methoxypropyl)amino]-N-(4-aminophenyl)-4-(oxiran-2-ylidene)but-2-enamide.
| Compound Name | (Z)-4-[(3-amino-2-methoxypropyl)amino]-N-(4-aminophenyl)-4-(oxiran-2-ylidene)but-2-enamide |
|---|---|
| PubChem CID | 144517855 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (Z)-4-[(3-amino-2-methoxypropyl)amino]-N-(4-aminophenyl)-4-(oxiran-2-ylidene)but-2-enamide |
| SMILES | COC(CN)CNC(/C=C\C(=O)Nc1ccc(N)cc1)=C1CO1 |
| InChI | InChI=1S/C16H22N4O3/c1-22-13(8-17)9-19-14(15-10-23-15)6-7-16(21)20-12-4-2-11(18)3-5-12/h2-7,13,19H,8-10,17-18H2,1H3,(H,20,21)/b7-6-,15-14? |
| InChIKey | APNLMGYVHPGURF-MEGSKQNKSA-N |
| XLogP | 0.57 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|