C10H14ClNO2 — CID 174576227
1-(2-amino-4-chloro-3,5-dimethylphenoxy)ethanol (PubChem CID 174576227) has the molecular formula C10H14ClNO2 and a molecular weight of 215.68 g/mol. Its IUPAC name is 1-(2-amino-4-chloro-3,5-dimethylphenoxy)ethanol.
| Compound Name | 1-(2-amino-4-chloro-3,5-dimethylphenoxy)ethanol |
|---|---|
| PubChem CID | 174576227 |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 1-(2-amino-4-chloro-3,5-dimethylphenoxy)ethanol |
| SMILES | Cc1cc(OC(C)O)c(N)c(C)c1Cl |
| InChI | InChI=1S/C10H14ClNO2/c1-5-4-8(14-7(3)13)10(12)6(2)9(5)11/h4,7,13H,12H2,1-3H3 |
| InChIKey | CSAQJOSIKWXGLV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|