C12H17ClN2O2 — CID 116843880
2-(3-chloro-6-methoxy-2,4-dimethylphenyl)propanehydrazide (PubChem CID 116843880) has the molecular formula C12H17ClN2O2 and a molecular weight of 256.73 g/mol. Its IUPAC name is 2-(3-chloro-6-methoxy-2,4-dimethylphenyl)propanehydrazide.
| Compound Name | 2-(3-chloro-6-methoxy-2,4-dimethylphenyl)propanehydrazide |
|---|---|
| PubChem CID | 116843880 |
| Molecular Formula | C12H17ClN2O2 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-(3-chloro-6-methoxy-2,4-dimethylphenyl)propanehydrazide |
| SMILES | COc1cc(C)c(Cl)c(C)c1C(C)C(=O)NN |
| InChI | InChI=1S/C12H17ClN2O2/c1-6-5-9(17-4)10(7(2)11(6)13)8(3)12(16)15-14/h5,8H,14H2,1-4H3,(H,15,16) |
| InChIKey | VARNIBQHNSLWEO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|