C19H22ClNO2 — CID 82265361
(3-aminophenyl)-[3-chloro-2,4-dimethyl-6-(2-methylpropoxy)phenyl]methanone (PubChem CID 82265361) has the molecular formula C19H22ClNO2 and a molecular weight of 331.84 g/mol. Its IUPAC name is (3-aminophenyl)-[3-chloro-2,4-dimethyl-6-(2-methylpropoxy)phenyl]methanone.
| Compound Name | (3-aminophenyl)-[3-chloro-2,4-dimethyl-6-(2-methylpropoxy)phenyl]methanone |
|---|---|
| PubChem CID | 82265361 |
| Molecular Formula | C19H22ClNO2 |
| Molecular Weight | 331.84 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | (3-aminophenyl)-[3-chloro-2,4-dimethyl-6-(2-methylpropoxy)phenyl]methanone |
| SMILES | Cc1cc(OCC(C)C)c(C(=O)c2cccc(N)c2)c(C)c1Cl |
| InChI | InChI=1S/C19H22ClNO2/c1-11(2)10-23-16-8-12(3)18(20)13(4)17(16)19(22)14-6-5-7-15(21)9-14/h5-9,11H,10,21H2,1-4H3 |
| InChIKey | OZGVDKSHAXDIRY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.84 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|