(2-hydroxy-4-methoxy-3,6-dimethylphenyl) hydrogen carbonate

C10H12O5 — CID 87860569

IUPAC(2-hydroxy-4-methoxy-3,6-dimethylphenyl) hydrogen carbonate
SMILESCOc1cc(C)c(OC(=O)O)c(O)c1C
InChIInChI=1S/C10H12O5/c1-5-4-7(14-3)6(2)8(11)9(5)15-10(12)13/h4,11H,1-3H3,(H,12,13)
InChIKeyOLRUERFUWKXOMF-UHFFFAOYSA-N
MW212.20 g/mol
LogP2.07
Rot. Bonds2

About (2-hydroxy-4-methoxy-3,6-dimethylphenyl) hydrogen carbonate

(2-hydroxy-4-methoxy-3,6-dimethylphenyl) hydrogen carbonate (PubChem CID 87860569) has the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. Its IUPAC name is (2-hydroxy-4-methoxy-3,6-dimethylphenyl) hydrogen carbonate.

Molecular Properties

Compound Name(2-hydroxy-4-methoxy-3,6-dimethylphenyl) hydrogen carbonate
PubChem CID87860569
Molecular FormulaC10H12O5
Molecular Weight212.20 g/mol
Exact Mass212.07
IUPAC Name(2-hydroxy-4-methoxy-3,6-dimethylphenyl) hydrogen carbonate
SMILESCOc1cc(C)c(OC(=O)O)c(O)c1C
InChIInChI=1S/C10H12O5/c1-5-4-7(14-3)6(2)8(11)9(5)15-10(12)13/h4,11H,1-3H3,(H,12,13)
InChIKeyOLRUERFUWKXOMF-UHFFFAOYSA-N
XLogP2.07
TPSA75.99 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.20
LogP ≤ 52.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}

Analyze (2-hydroxy-4-methoxy-3,6-dimethylphenyl) hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-hydroxy-4-methoxy-3,6-dimethylphenyl) hydrogen carbonate?
The IUPAC name of (2-hydroxy-4-methoxy-3,6-dimethylphenyl) hydrogen carbonate (CID 87860569) is (2-hydroxy-4-methoxy-3,6-dimethylphenyl) hydrogen carbonate.
What is the SMILES notation for (2-hydroxy-4-methoxy-3,6-dimethylphenyl) hydrogen carbonate?
The canonical SMILES for (2-hydroxy-4-methoxy-3,6-dimethylphenyl) hydrogen carbonate is COc1cc(C)c(OC(=O)O)c(O)c1C.
What is the InChIKey of (2-hydroxy-4-methoxy-3,6-dimethylphenyl) hydrogen carbonate?
The InChIKey is OLRUERFUWKXOMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O5/c1-5-4-7(14-3)6(2)8(11)9(5)15-10(12)13/h4,11H,1-3H3,(H,12,13).
What are the key properties of (2-hydroxy-4-methoxy-3,6-dimethylphenyl) hydrogen carbonate?
(2-hydroxy-4-methoxy-3,6-dimethylphenyl) hydrogen carbonate has a molecular weight of 212.20 g/mol, XLogP of 2.07, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-4-methoxy-3,6-dimethylphenyl) hydrogen carbonate is sourced from PubChem (CID 87860569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).