C11H17ClN2O — CID 115226535
N'-(3-chloro-6-methoxy-2,4-dimethylphenyl)-N-methylmethanediamine (PubChem CID 115226535) has the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. Its IUPAC name is N'-(3-chloro-6-methoxy-2,4-dimethylphenyl)-N-methylmethanediamine.
| Compound Name | N'-(3-chloro-6-methoxy-2,4-dimethylphenyl)-N-methylmethanediamine |
|---|---|
| PubChem CID | 115226535 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | N'-(3-chloro-6-methoxy-2,4-dimethylphenyl)-N-methylmethanediamine |
| SMILES | CNCNc1c(OC)cc(C)c(Cl)c1C |
| InChI | InChI=1S/C11H17ClN2O/c1-7-5-9(15-4)11(14-6-13-3)8(2)10(7)12/h5,13-14H,6H2,1-4H3 |
| InChIKey | CAWSTIWAOJDBDU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|