C14H21BrClNO — CID 115262572
N-(bromomethyl)-2-(3-chloro-6-methoxy-2,4-dimethylphenyl)-2-methylpropan-1-amine (PubChem CID 115262572) has the molecular formula C14H21BrClNO and a molecular weight of 334.69 g/mol. Its IUPAC name is N-(bromomethyl)-2-(3-chloro-6-methoxy-2,4-dimethylphenyl)-2-methylpropan-1-amine.
| Compound Name | N-(bromomethyl)-2-(3-chloro-6-methoxy-2,4-dimethylphenyl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 115262572 |
| Molecular Formula | C14H21BrClNO |
| Molecular Weight | 334.69 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | N-(bromomethyl)-2-(3-chloro-6-methoxy-2,4-dimethylphenyl)-2-methylpropan-1-amine |
| SMILES | COc1cc(C)c(Cl)c(C)c1C(C)(C)CNCBr |
| InChI | InChI=1S/C14H21BrClNO/c1-9-6-11(18-5)12(10(2)13(9)16)14(3,4)7-17-8-15/h6,17H,7-8H2,1-5H3 |
| InChIKey | RMEWFKTXMIWLQK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.69 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|