C14H22BrNO2 — CID 115262577
N-(bromomethyl)-2-(2,4-dimethoxy-3-methylphenyl)-2-methylpropan-1-amine (PubChem CID 115262577) has the molecular formula C14H22BrNO2 and a molecular weight of 316.24 g/mol. Its IUPAC name is N-(bromomethyl)-2-(2,4-dimethoxy-3-methylphenyl)-2-methylpropan-1-amine.
| Compound Name | N-(bromomethyl)-2-(2,4-dimethoxy-3-methylphenyl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 115262577 |
| Molecular Formula | C14H22BrNO2 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | N-(bromomethyl)-2-(2,4-dimethoxy-3-methylphenyl)-2-methylpropan-1-amine |
| SMILES | COc1ccc(C(C)(C)CNCBr)c(OC)c1C |
| InChI | InChI=1S/C14H22BrNO2/c1-10-12(17-4)7-6-11(13(10)18-5)14(2,3)8-16-9-15/h6-7,16H,8-9H2,1-5H3 |
| InChIKey | JOBFPNPUAWJGKW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|